C24H25N4O3+ — CID 7068427
1-(2,3-dimethylphenyl)-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione (PubChem CID 7068427) has the molecular formula C24H25N4O3+ and a molecular weight of 417.49 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione.
| Compound Name | 1-(2,3-dimethylphenyl)-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 7068427 |
| Molecular Formula | C24H25N4O3+ |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-6-hydroxy-5-[(1R)-2-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cccc(-n2c(O)c([C@@H]3c4[nH]c5ccccc5c4CC[NH+]3C)c(=O)[nH]c2=O)c1C |
| InChI | InChI=1S/C24H24N4O3/c1-13-7-6-10-18(14(13)2)28-23(30)19(22(29)26-24(28)31)21-20-16(11-12-27(21)3)15-8-4-5-9-17(15)25-20/h4-10,21,25,30H,11-12H2,1-3H3,(H,26,29,31)/p+1/t21-/m1/s1 |
| InChIKey | QORLVXQBHUPOLN-OAQYLSRUSA-O |
| XLogP | 1.49 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|