C21H26N4O3 — CID 29055051
1-tert-butyl-5-[(1S)-2-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 29055051) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-tert-butyl-5-[(1S)-2-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-tert-butyl-5-[(1S)-2-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 29055051 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-tert-butyl-5-[(1S)-2-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCN1CCc2c([nH]c3ccccc23)[C@@H]1c1c(O)n(C(C)(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H26N4O3/c1-5-24-11-10-13-12-8-6-7-9-14(12)22-16(13)17(24)15-18(26)23-20(28)25(19(15)27)21(2,3)4/h6-9,17,22,27H,5,10-11H2,1-4H3,(H,23,26,28)/t17-/m0/s1 |
| InChIKey | HQBXXDAOGXVSJG-KRWDZBQOSA-N |
| XLogP | 2.45 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|