C25H26N4O3 — CID 98369073
5-[(1S)-2-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione (PubChem CID 98369073) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 5-[(1S)-2-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione.
| Compound Name | 5-[(1S)-2-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 98369073 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 5-[(1S)-2-ethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-6-hydroxy-1-[(1R)-1-phenylethyl]pyrimidine-2,4-dione |
| SMILES | CCN1CCc2c([nH]c3ccccc23)[C@@H]1c1c(O)n([C@H](C)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H26N4O3/c1-3-28-14-13-18-17-11-7-8-12-19(17)26-21(18)22(28)20-23(30)27-25(32)29(24(20)31)15(2)16-9-5-4-6-10-16/h4-12,15,22,26,31H,3,13-14H2,1-2H3,(H,27,30,32)/t15-,22+/m1/s1 |
| InChIKey | YEWBPLSESYXMLI-QRQCRPRQSA-N |
| XLogP | 3.30 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|