C22H23N2O5+ — CID 70687169
(2S,3R,4S,5R)-2-(9-hydroxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 70687169) has the molecular formula C22H23N2O5+ and a molecular weight of 395.44 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(9-hydroxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(9-hydroxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70687169 |
| Molecular Formula | C22H23N2O5+ |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (2S,3R,4S,5R)-2-(9-hydroxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium-2-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Cc1c2cc[n+]([C@H]3O[C@H](CO)[C@@H](O)[C@H]3O)cc2c(C)c2c1[nH]c1ccc(O)cc12 |
| InChI | InChI=1S/C22H22N2O5/c1-10-15-8-24(22-21(28)20(27)17(9-25)29-22)6-5-13(15)11(2)19-18(10)14-7-12(26)3-4-16(14)23-19/h3-8,17,20-22,25-28H,9H2,1-2H3/p+1/t17-,20-,21-,22+/m1/s1 |
| InChIKey | PKNVFFTUOHPWON-CIQXWFTPSA-O |
| XLogP | 1.70 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|