C30H35ClN4O3 — CID 70688227
1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-5,5-diphenylimidazolidine-2,4-dione;hydrochloride (PubChem CID 70688227) has the molecular formula C30H35ClN4O3 and a molecular weight of 535.09 g/mol. Its IUPAC name is 1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-5,5-diphenylimidazolidine-2,4-dione;hydrochloride.
| Compound Name | 1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-5,5-diphenylimidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 70688227 |
| Molecular Formula | C30H35ClN4O3 |
| Molecular Weight | 535.09 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 1-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-5,5-diphenylimidazolidine-2,4-dione;hydrochloride |
| SMILES | COc1ccccc1N1CCN(CCCN2C(=O)N(C)C(=O)C2(c2ccccc2)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C30H34N4O3.ClH/c1-31-28(35)30(24-12-5-3-6-13-24,25-14-7-4-8-15-25)34(29(31)36)19-11-18-32-20-22-33(23-21-32)26-16-9-10-17-27(26)37-2;/h3-10,12-17H,11,18-23H2,1-2H3;1H |
| InChIKey | NGSAIUNKCLGEDL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.09 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|