C29H23NO10 — CID 70691796
methyl 4-[5-[(E)-2-cyano-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-7-methoxy-1,3-benzodioxol-4-yl]-7-methoxy-1,3-benzodioxole-5-carboxylate (PubChem CID 70691796) has the molecular formula C29H23NO10 and a molecular weight of 545.50 g/mol. Its IUPAC name is methyl 4-[5-[(E)-2-cyano-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-7-methoxy-1,3-benzodioxol-4-yl]-7-methoxy-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl 4-[5-[(E)-2-cyano-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-7-methoxy-1,3-benzodioxol-4-yl]-7-methoxy-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 70691796 |
| Molecular Formula | C29H23NO10 |
| Molecular Weight | 545.50 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | methyl 4-[5-[(E)-2-cyano-3-(4-methoxyphenyl)-3-oxoprop-1-enyl]-7-methoxy-1,3-benzodioxol-4-yl]-7-methoxy-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)c1cc(OC)c2c(c1-c1c(/C=C(\C#N)C(=O)c3ccc(OC)cc3)cc(OC)c3c1OCO3)OCO2 |
| InChI | InChI=1S/C29H23NO10/c1-33-18-7-5-15(6-8-18)24(31)17(12-30)9-16-10-20(34-2)25-27(39-13-37-25)22(16)23-19(29(32)36-4)11-21(35-3)26-28(23)40-14-38-26/h5-11H,13-14H2,1-4H3/b17-9+ |
| InChIKey | VGTLUAPXRLSLCE-RQZCQDPDSA-N |
| XLogP | 4.41 |
| TPSA | 131.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|