C24H32N8 — CID 70694367
6-N-methyl-2-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 70694367) has the molecular formula C24H32N8 and a molecular weight of 432.58 g/mol. Its IUPAC name is 6-N-methyl-2-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-methyl-2-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 70694367 |
| Molecular Formula | C24H32N8 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 6-N-methyl-2-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-N-(2,4,6-trimethylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(Nc2c(C)cc(C)cc2C)nc(NC2CCN(Cc3ccncc3)CC2)n1 |
| InChI | InChI=1S/C24H32N8/c1-16-13-17(2)21(18(3)14-16)28-24-30-22(25-4)29-23(31-24)27-20-7-11-32(12-8-20)15-19-5-9-26-10-6-19/h5-6,9-10,13-14,20H,7-8,11-12,15H2,1-4H3,(H3,25,27,28,29,30,31) |
| InChIKey | AABFIPXCNDBECC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |