C13H8N2O4 — CID 70696472
5-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 70696472) has the molecular formula C13H8N2O4 and a molecular weight of 256.22 g/mol. Its IUPAC name is 5-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 70696472 |
| Molecular Formula | C13H8N2O4 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 5-phenyl-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | O=c1[nH]c(=O)c2c(-c3ccccc3)cc(=O)oc2[nH]1 |
| InChI | InChI=1S/C13H8N2O4/c16-9-6-8(7-4-2-1-3-5-7)10-11(17)14-13(18)15-12(10)19-9/h1-6H,(H2,14,15,17,18) |
| InChIKey | BREQCGFCJJGAMY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |