C20H17N5O2 — CID 70697456
1-benzyl-N-(4-methyl-3-nitrophenyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 70697456) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 1-benzyl-N-(4-methyl-3-nitrophenyl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 1-benzyl-N-(4-methyl-3-nitrophenyl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 70697456 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 1-benzyl-N-(4-methyl-3-nitrophenyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1ccc(Nc2nc3ncccc3n2Cc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17N5O2/c1-14-9-10-16(12-18(14)25(26)27)22-20-23-19-17(8-5-11-21-19)24(20)13-15-6-3-2-4-7-15/h2-12H,13H2,1H3,(H,21,22,23) |
| InChIKey | PNOQJJSOSXGRIT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|