C6HBrCl2F2 — CID 70699617
1-bromo-2,4-dichloro-3,5-difluorobenzene (PubChem CID 70699617) has the molecular formula C6HBrCl2F2 and a molecular weight of 261.88 g/mol. Its IUPAC name is 1-bromo-2,4-dichloro-3,5-difluorobenzene.
| Compound Name | 1-bromo-2,4-dichloro-3,5-difluorobenzene |
|---|---|
| PubChem CID | 70699617 |
| Molecular Formula | C6HBrCl2F2 |
| Molecular Weight | 261.88 g/mol |
| Exact Mass | 259.86 |
| IUPAC Name | 1-bromo-2,4-dichloro-3,5-difluorobenzene |
| SMILES | Fc1cc(Br)c(Cl)c(F)c1Cl |
| InChI | InChI=1S/C6HBrCl2F2/c7-2-1-3(10)5(9)6(11)4(2)8/h1H |
| InChIKey | JMZSSKGAWNYCOL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|