C23H27ClN2O4 — CID 70700199
9H-fluoren-9-ylmethyl N-(8-amino-3,6-dioxooctyl)carbamate;hydrochloride (PubChem CID 70700199) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(8-amino-3,6-dioxooctyl)carbamate;hydrochloride.
| Compound Name | 9H-fluoren-9-ylmethyl N-(8-amino-3,6-dioxooctyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 70700199 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(8-amino-3,6-dioxooctyl)carbamate;hydrochloride |
| SMILES | Cl.NCCC(=O)CCC(=O)CCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H26N2O4.ClH/c24-13-11-16(26)9-10-17(27)12-14-25-23(28)29-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22;/h1-8,22H,9-15,24H2,(H,25,28);1H |
| InChIKey | XCEUTTUALOJQDL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |