C16H19N2O4- — CID 7070170
(2S)-2-[(5-methoxy-1-methylindole-2-carbonyl)amino]-3-methylbutanoate (PubChem CID 7070170) has the molecular formula C16H19N2O4- and a molecular weight of 303.34 g/mol. Its IUPAC name is (2S)-2-[(5-methoxy-1-methylindole-2-carbonyl)amino]-3-methylbutanoate.
| Compound Name | (2S)-2-[(5-methoxy-1-methylindole-2-carbonyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7070170 |
| Molecular Formula | C16H19N2O4- |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (2S)-2-[(5-methoxy-1-methylindole-2-carbonyl)amino]-3-methylbutanoate |
| SMILES | COc1ccc2c(c1)cc(C(=O)N[C@H](C(=O)[O-])C(C)C)n2C |
| InChI | InChI=1S/C16H20N2O4/c1-9(2)14(16(20)21)17-15(19)13-8-10-7-11(22-4)5-6-12(10)18(13)3/h5-9,14H,1-4H3,(H,17,19)(H,20,21)/p-1/t14-/m0/s1 |
| InChIKey | KBXOEDZMWWNJPZ-AWEZNQCLSA-M |
| XLogP | 0.69 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |