C23H25N3O5 — CID 4868507
2-[2-[(5-methoxy-1-methylindole-2-carbonyl)amino]propanoylamino]-3-phenylpropanoic acid (PubChem CID 4868507) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[2-[(5-methoxy-1-methylindole-2-carbonyl)amino]propanoylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[2-[(5-methoxy-1-methylindole-2-carbonyl)amino]propanoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 4868507 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[2-[(5-methoxy-1-methylindole-2-carbonyl)amino]propanoylamino]-3-phenylpropanoic acid |
| SMILES | COc1ccc2c(c1)cc(C(=O)NC(C)C(=O)NC(Cc1ccccc1)C(=O)O)n2C |
| InChI | InChI=1S/C23H25N3O5/c1-14(21(27)25-18(23(29)30)11-15-7-5-4-6-8-15)24-22(28)20-13-16-12-17(31-3)9-10-19(16)26(20)2/h4-10,12-14,18H,11H2,1-3H3,(H,24,28)(H,25,27)(H,29,30) |
| InChIKey | MEBVLBJYNRITMR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |