C22H22ClN3O4 — CID 4837291
2-[[2-[(5-chloro-1-methylindole-2-carbonyl)amino]-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 4837291) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is 2-[[2-[(5-chloro-1-methylindole-2-carbonyl)amino]-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[(5-chloro-1-methylindole-2-carbonyl)amino]-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 4837291 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-[[2-[(5-chloro-1-methylindole-2-carbonyl)amino]-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(Cc1ccccc1)NC(=O)c1cc2cc(Cl)ccc2n1C)C(=O)O |
| InChI | InChI=1S/C22H22ClN3O4/c1-13(22(29)30)24-20(27)17(10-14-6-4-3-5-7-14)25-21(28)19-12-15-11-16(23)8-9-18(15)26(19)2/h3-9,11-13,17H,10H2,1-2H3,(H,24,27)(H,25,28)(H,29,30) |
| InChIKey | CXXSLXBWZJJKJP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |