C20H19ClFN5O — CID 70702157
4-N-(2-chlorophenyl)-5-fluoro-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 70702157) has the molecular formula C20H19ClFN5O and a molecular weight of 399.86 g/mol. Its IUPAC name is 4-N-(2-chlorophenyl)-5-fluoro-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-chlorophenyl)-5-fluoro-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 70702157 |
| Molecular Formula | C20H19ClFN5O |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4-N-(2-chlorophenyl)-5-fluoro-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Fc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1Nc1ccccc1Cl |
| InChI | InChI=1S/C20H19ClFN5O/c21-16-3-1-2-4-18(16)25-19-17(22)13-23-20(26-19)24-14-5-7-15(8-6-14)27-9-11-28-12-10-27/h1-8,13H,9-12H2,(H2,23,24,25,26) |
| InChIKey | GGUACUDIPNNWFV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|