C16H12ClFN4 — CID 70702128
4-N-(2-chlorophenyl)-5-fluoro-2-N-phenylpyrimidine-2,4-diamine (PubChem CID 70702128) has the molecular formula C16H12ClFN4 and a molecular weight of 314.75 g/mol. Its IUPAC name is 4-N-(2-chlorophenyl)-5-fluoro-2-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-chlorophenyl)-5-fluoro-2-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 70702128 |
| Molecular Formula | C16H12ClFN4 |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-N-(2-chlorophenyl)-5-fluoro-2-N-phenylpyrimidine-2,4-diamine |
| SMILES | Fc1cnc(Nc2ccccc2)nc1Nc1ccccc1Cl |
| InChI | InChI=1S/C16H12ClFN4/c17-12-8-4-5-9-14(12)21-15-13(18)10-19-16(22-15)20-11-6-2-1-3-7-11/h1-10H,(H2,19,20,21,22) |
| InChIKey | WDVBUDQGXBFWKL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |