C16H27N5O3S — CID 70703503
4-[4-(4-butylsulfonylpiperazin-1-yl)pyrimidin-2-yl]morpholine (PubChem CID 70703503) has the molecular formula C16H27N5O3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 4-[4-(4-butylsulfonylpiperazin-1-yl)pyrimidin-2-yl]morpholine.
| Compound Name | 4-[4-(4-butylsulfonylpiperazin-1-yl)pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 70703503 |
| Molecular Formula | C16H27N5O3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 4-[4-(4-butylsulfonylpiperazin-1-yl)pyrimidin-2-yl]morpholine |
| SMILES | CCCCS(=O)(=O)N1CCN(c2ccnc(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C16H27N5O3S/c1-2-3-14-25(22,23)21-8-6-19(7-9-21)15-4-5-17-16(18-15)20-10-12-24-13-11-20/h4-5H,2-3,6-14H2,1H3 |
| InChIKey | RSQOSDQWOMPIIQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |