C16H26ClN3O4 — CID 70704157
N-[3-[1-hydroxy-2-(2-methoxyethylamino)ethyl]phenyl]-N'-propan-2-yloxamide;hydrochloride (PubChem CID 70704157) has the molecular formula C16H26ClN3O4 and a molecular weight of 359.85 g/mol. Its IUPAC name is N-[3-[1-hydroxy-2-(2-methoxyethylamino)ethyl]phenyl]-N'-propan-2-yloxamide;hydrochloride.
| Compound Name | N-[3-[1-hydroxy-2-(2-methoxyethylamino)ethyl]phenyl]-N'-propan-2-yloxamide;hydrochloride |
|---|---|
| PubChem CID | 70704157 |
| Molecular Formula | C16H26ClN3O4 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[3-[1-hydroxy-2-(2-methoxyethylamino)ethyl]phenyl]-N'-propan-2-yloxamide;hydrochloride |
| SMILES | COCCNCC(O)c1cccc(NC(=O)C(=O)NC(C)C)c1.Cl |
| InChI | InChI=1S/C16H25N3O4.ClH/c1-11(2)18-15(21)16(22)19-13-6-4-5-12(9-13)14(20)10-17-7-8-23-3;/h4-6,9,11,14,17,20H,7-8,10H2,1-3H3,(H,18,21)(H,19,22);1H |
| InChIKey | ORFFBGPVPXNVRE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|