C18H16N2O4 — CID 707052
ethyl 4-[(1,3-dioxoisoindol-2-yl)methylamino]benzoate (PubChem CID 707052) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is ethyl 4-[(1,3-dioxoisoindol-2-yl)methylamino]benzoate.
| Compound Name | ethyl 4-[(1,3-dioxoisoindol-2-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 707052 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | ethyl 4-[(1,3-dioxoisoindol-2-yl)methylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H16N2O4/c1-2-24-18(23)12-7-9-13(10-8-12)19-11-20-16(21)14-5-3-4-6-15(14)17(20)22/h3-10,19H,2,11H2,1H3 |
| InChIKey | UBQTZGQXQLUMKZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|