C19H24N2O3S — CID 70707240
N-(1,1-dioxothian-4-yl)-6-ethyl-N,2-dimethylquinoline-4-carboxamide (PubChem CID 70707240) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-6-ethyl-N,2-dimethylquinoline-4-carboxamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-6-ethyl-N,2-dimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 70707240 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-6-ethyl-N,2-dimethylquinoline-4-carboxamide |
| SMILES | CCc1ccc2nc(C)cc(C(=O)N(C)C3CCS(=O)(=O)CC3)c2c1 |
| InChI | InChI=1S/C19H24N2O3S/c1-4-14-5-6-18-16(12-14)17(11-13(2)20-18)19(22)21(3)15-7-9-25(23,24)10-8-15/h5-6,11-12,15H,4,7-10H2,1-3H3 |
| InChIKey | JYJCKLSMWISNNO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |