C19H31N5O2 — CID 70707810
(E)-1-[4-[4-methyl-5-(morpholin-4-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hex-3-en-1-one (PubChem CID 70707810) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (E)-1-[4-[4-methyl-5-(morpholin-4-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hex-3-en-1-one.
| Compound Name | (E)-1-[4-[4-methyl-5-(morpholin-4-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hex-3-en-1-one |
|---|---|
| PubChem CID | 70707810 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | (E)-1-[4-[4-methyl-5-(morpholin-4-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hex-3-en-1-one |
| SMILES | CC/C=C/CC(=O)N1CCC(c2nnc(CN3CCOCC3)n2C)CC1 |
| InChI | InChI=1S/C19H31N5O2/c1-3-4-5-6-18(25)24-9-7-16(8-10-24)19-21-20-17(22(19)2)15-23-11-13-26-14-12-23/h4-5,16H,3,6-15H2,1-2H3/b5-4+ |
| InChIKey | JEAZKBQCZLHMIU-SNAWJCMRSA-N |
| XLogP | 1.71 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|