C14H22N4O2S — CID 70708422
(4aR,7aS)-1-(cyclopropylmethyl)-4-(1H-imidazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70708422) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is (4aR,7aS)-1-(cyclopropylmethyl)-4-(1H-imidazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-1-(cyclopropylmethyl)-4-(1H-imidazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70708422 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (4aR,7aS)-1-(cyclopropylmethyl)-4-(1H-imidazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | O=S1(=O)C[C@@H]2[C@H](C1)N(Cc1ncc[nH]1)CCN2CC1CC1 |
| InChI | InChI=1S/C14H22N4O2S/c19-21(20)9-12-13(10-21)18(8-14-15-3-4-16-14)6-5-17(12)7-11-1-2-11/h3-4,11-13H,1-2,5-10H2,(H,15,16)/t12-,13+/m1/s1 |
| InChIKey | HQXSCKKAIKUZRC-OLZOCXBDSA-N |
| XLogP | 0.10 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |