C15H24N4O2S — CID 70783585
(4aR,7aS)-4-(1H-imidazol-2-ylmethyl)-1-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70783585) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is (4aR,7aS)-4-(1H-imidazol-2-ylmethyl)-1-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-(1H-imidazol-2-ylmethyl)-1-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70783585 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (4aR,7aS)-4-(1H-imidazol-2-ylmethyl)-1-(3-methylbut-2-enyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CC(C)=CCN1CCN(Cc2ncc[nH]2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H24N4O2S/c1-12(2)3-6-18-7-8-19(9-15-16-4-5-17-15)14-11-22(20,21)10-13(14)18/h3-5,13-14H,6-11H2,1-2H3,(H,16,17)/t13-,14+/m1/s1 |
| InChIKey | CCEJOPIHGCITTE-KGLIPLIRSA-N |
| XLogP | 0.66 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|