C21H26O2 — CID 7070925
(8aS,9R,10S,10aR)-10-phenyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-9-carboxylic acid (PubChem CID 7070925) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (8aS,9R,10S,10aR)-10-phenyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-9-carboxylic acid.
| Compound Name | (8aS,9R,10S,10aR)-10-phenyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-9-carboxylic acid |
|---|---|
| PubChem CID | 7070925 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (8aS,9R,10S,10aR)-10-phenyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-9-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@@H](c2ccccc2)[C@H]2CCCCC2=C2CCCC[C@H]21 |
| InChI | InChI=1S/C21H26O2/c22-21(23)20-18-13-7-5-11-16(18)15-10-4-6-12-17(15)19(20)14-8-2-1-3-9-14/h1-3,8-9,17-20H,4-7,10-13H2,(H,22,23)/t17-,18+,19-,20+/m0/s1 |
| InChIKey | XYVBIIPPBRNKCC-ZGXWSNOMSA-N |
| XLogP | 5.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|