C22H25O3- — CID 11871174
(8aR,9S,10R,10aS)-10-benzoyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-9-carboxylate (PubChem CID 11871174) has the molecular formula C22H25O3- and a molecular weight of 337.44 g/mol. Its IUPAC name is (8aR,9S,10R,10aS)-10-benzoyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-9-carboxylate.
| Compound Name | (8aR,9S,10R,10aS)-10-benzoyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-9-carboxylate |
|---|---|
| PubChem CID | 11871174 |
| Molecular Formula | C22H25O3- |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (8aR,9S,10R,10aS)-10-benzoyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-9-carboxylate |
| SMILES | O=C([O-])[C@@H]1[C@H](C(=O)c2ccccc2)[C@@H]2CCCCC2=C2CCCC[C@@H]21 |
| InChI | InChI=1S/C22H26O3/c23-21(14-8-2-1-3-9-14)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)20(19)22(24)25/h1-3,8-9,17-20H,4-7,10-13H2,(H,24,25)/p-1/t17-,18+,19-,20+/m1/s1 |
| InChIKey | DKWBQLNOCXTUPX-WCIQWLHISA-M |
| XLogP | 3.54 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|