About 7-benzoylazepan-2-one
7-benzoylazepan-2-one (PubChem CID 70255305) has the molecular formula C26H30N2O4
and a molecular weight of 434.54 g/mol. Its IUPAC name is 7-benzoylazepan-2-one.
Molecular Properties
| Compound Name | 7-benzoylazepan-2-one |
| PubChem CID | 70255305 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 7-benzoylazepan-2-one |
| SMILES | O=C1CCCCC(C(=O)c2ccccc2)N1.O=C1CCCCC(C(=O)c2ccccc2)N1 |
| InChI | InChI=1S/2C13H15NO2/c2*15-12-9-5-4-8-11(14-12)13(16)10-6-2-1-3-7-10/h2*1-3,6-7,11H,4-5,8-9H2,(H,14,15) |
| InChIKey | JAPWKFBYDPHYNV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-benzoylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzoylazepan-2-one?
The IUPAC name of 7-benzoylazepan-2-one (CID 70255305) is 7-benzoylazepan-2-one.
What is the SMILES notation for 7-benzoylazepan-2-one?
The canonical SMILES for 7-benzoylazepan-2-one is O=C1CCCCC(C(=O)c2ccccc2)N1.O=C1CCCCC(C(=O)c2ccccc2)N1.
What is the InChIKey of 7-benzoylazepan-2-one?
The InChIKey is JAPWKFBYDPHYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H15NO2/c2*15-12-9-5-4-8-11(14-12)13(16)10-6-2-1-3-7-10/h2*1-3,6-7,11H,4-5,8-9H2,(H,14,15).
What are the key properties of 7-benzoylazepan-2-one?
7-benzoylazepan-2-one has a molecular weight of 434.54 g/mol, XLogP of 3.86, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzoylazepan-2-one is sourced from PubChem (CID 70255305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).