C18H26ClFN2O2 — CID 70713874
1-[(3-chloro-5-fluoro-4-methoxyphenyl)methyl]-3-(pyrrolidin-1-ylmethyl)piperidin-3-ol (PubChem CID 70713874) has the molecular formula C18H26ClFN2O2 and a molecular weight of 356.87 g/mol. Its IUPAC name is 1-[(3-chloro-5-fluoro-4-methoxyphenyl)methyl]-3-(pyrrolidin-1-ylmethyl)piperidin-3-ol.
| Compound Name | 1-[(3-chloro-5-fluoro-4-methoxyphenyl)methyl]-3-(pyrrolidin-1-ylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 70713874 |
| Molecular Formula | C18H26ClFN2O2 |
| Molecular Weight | 356.87 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-[(3-chloro-5-fluoro-4-methoxyphenyl)methyl]-3-(pyrrolidin-1-ylmethyl)piperidin-3-ol |
| SMILES | COc1c(F)cc(CN2CCCC(O)(CN3CCCC3)C2)cc1Cl |
| InChI | InChI=1S/C18H26ClFN2O2/c1-24-17-15(19)9-14(10-16(17)20)11-22-8-4-5-18(23,13-22)12-21-6-2-3-7-21/h9-10,23H,2-8,11-13H2,1H3 |
| InChIKey | YAWGEZSNMDIBEH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.87 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |