C21H22N8 — CID 70715525
2-cyclohexyl-5-[1-[[3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-2-yl]pyrimidine (PubChem CID 70715525) has the molecular formula C21H22N8 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-cyclohexyl-5-[1-[[3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-2-yl]pyrimidine.
| Compound Name | 2-cyclohexyl-5-[1-[[3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-2-yl]pyrimidine |
|---|---|
| PubChem CID | 70715525 |
| Molecular Formula | C21H22N8 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-cyclohexyl-5-[1-[[3-(2H-tetrazol-5-yl)phenyl]methyl]imidazol-2-yl]pyrimidine |
| SMILES | c1cc(Cn2ccnc2-c2cnc(C3CCCCC3)nc2)cc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C21H22N8/c1-2-6-16(7-3-1)19-23-12-18(13-24-19)21-22-9-10-29(21)14-15-5-4-8-17(11-15)20-25-27-28-26-20/h4-5,8-13,16H,1-3,6-7,14H2,(H,25,26,27,28) |
| InChIKey | SNVJSPNCKYDOEP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |