C15H22N6O2S — CID 70716018
5-methylsulfonyl-4-piperidin-3-yl-N-(2-pyrazol-1-ylethyl)pyrimidin-2-amine (PubChem CID 70716018) has the molecular formula C15H22N6O2S and a molecular weight of 350.45 g/mol. Its IUPAC name is 5-methylsulfonyl-4-piperidin-3-yl-N-(2-pyrazol-1-ylethyl)pyrimidin-2-amine.
| Compound Name | 5-methylsulfonyl-4-piperidin-3-yl-N-(2-pyrazol-1-ylethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 70716018 |
| Molecular Formula | C15H22N6O2S |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 5-methylsulfonyl-4-piperidin-3-yl-N-(2-pyrazol-1-ylethyl)pyrimidin-2-amine |
| SMILES | CS(=O)(=O)c1cnc(NCCn2cccn2)nc1C1CCCNC1 |
| InChI | InChI=1S/C15H22N6O2S/c1-24(22,23)13-11-18-15(17-7-9-21-8-3-6-19-21)20-14(13)12-4-2-5-16-10-12/h3,6,8,11-12,16H,2,4-5,7,9-10H2,1H3,(H,17,18,20) |
| InChIKey | MAAAMAOCYAIVRQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |