C17H29N5O2S — CID 95893655
5-methylsulfonyl-4-[(3R)-piperidin-3-yl]-N-(2-piperidin-1-ylethyl)pyrimidin-2-amine (PubChem CID 95893655) has the molecular formula C17H29N5O2S and a molecular weight of 367.52 g/mol. Its IUPAC name is 5-methylsulfonyl-4-[(3R)-piperidin-3-yl]-N-(2-piperidin-1-ylethyl)pyrimidin-2-amine.
| Compound Name | 5-methylsulfonyl-4-[(3R)-piperidin-3-yl]-N-(2-piperidin-1-ylethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 95893655 |
| Molecular Formula | C17H29N5O2S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 5-methylsulfonyl-4-[(3R)-piperidin-3-yl]-N-(2-piperidin-1-ylethyl)pyrimidin-2-amine |
| SMILES | CS(=O)(=O)c1cnc(NCCN2CCCCC2)nc1[C@@H]1CCCNC1 |
| InChI | InChI=1S/C17H29N5O2S/c1-25(23,24)15-13-20-17(19-8-11-22-9-3-2-4-10-22)21-16(15)14-6-5-7-18-12-14/h13-14,18H,2-12H2,1H3,(H,19,20,21)/t14-/m1/s1 |
| InChIKey | BNUXBWPWJFAWQJ-CQSZACIVSA-N |
| XLogP | 1.24 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |