C17H29N5O3S — CID 70779319
1-methyl-4-[[(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)amino]methyl]piperidin-4-ol (PubChem CID 70779319) has the molecular formula C17H29N5O3S and a molecular weight of 383.52 g/mol. Its IUPAC name is 1-methyl-4-[[(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)amino]methyl]piperidin-4-ol.
| Compound Name | 1-methyl-4-[[(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)amino]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 70779319 |
| Molecular Formula | C17H29N5O3S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-methyl-4-[[(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)amino]methyl]piperidin-4-ol |
| SMILES | CN1CCC(O)(CNc2ncc(S(C)(=O)=O)c(C3CCCNC3)n2)CC1 |
| InChI | InChI=1S/C17H29N5O3S/c1-22-8-5-17(23,6-9-22)12-20-16-19-11-14(26(2,24)25)15(21-16)13-4-3-7-18-10-13/h11,13,18,23H,3-10,12H2,1-2H3,(H,19,20,21) |
| InChIKey | CADFCNWXXOXGPG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |