C15H25N5O2S — CID 95543228
2-(4-methylpiperazin-1-yl)-5-methylsulfonyl-4-[(3S)-piperidin-3-yl]pyrimidine (PubChem CID 95543228) has the molecular formula C15H25N5O2S and a molecular weight of 339.47 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-5-methylsulfonyl-4-[(3S)-piperidin-3-yl]pyrimidine.
| Compound Name | 2-(4-methylpiperazin-1-yl)-5-methylsulfonyl-4-[(3S)-piperidin-3-yl]pyrimidine |
|---|---|
| PubChem CID | 95543228 |
| Molecular Formula | C15H25N5O2S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-5-methylsulfonyl-4-[(3S)-piperidin-3-yl]pyrimidine |
| SMILES | CN1CCN(c2ncc(S(C)(=O)=O)c([C@H]3CCCNC3)n2)CC1 |
| InChI | InChI=1S/C15H25N5O2S/c1-19-6-8-20(9-7-19)15-17-11-13(23(2,21)22)14(18-15)12-4-3-5-16-10-12/h11-12,16H,3-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | VDHCEGZAVJTBBW-LBPRGKRZSA-N |
| XLogP | 0.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |