C16H27ClN4O2S — CID 154888601
1-(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)azepane;hydrochloride (PubChem CID 154888601) has the molecular formula C16H27ClN4O2S and a molecular weight of 374.94 g/mol. Its IUPAC name is 1-(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)azepane;hydrochloride.
| Compound Name | 1-(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)azepane;hydrochloride |
|---|---|
| PubChem CID | 154888601 |
| Molecular Formula | C16H27ClN4O2S |
| Molecular Weight | 374.94 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)azepane;hydrochloride |
| SMILES | CS(=O)(=O)c1cnc(N2CCCCCC2)nc1C1CCCNC1.Cl |
| InChI | InChI=1S/C16H26N4O2S.ClH/c1-23(21,22)14-12-18-16(20-9-4-2-3-5-10-20)19-15(14)13-7-6-8-17-11-13;/h12-13,17H,2-11H2,1H3;1H |
| InChIKey | SEDFPMXFUMEMAY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.94 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |