C17H29ClN4O2S — CID 154885101
1-(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)azocane;hydrochloride (PubChem CID 154885101) has the molecular formula C17H29ClN4O2S and a molecular weight of 388.97 g/mol. Its IUPAC name is 1-(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)azocane;hydrochloride.
| Compound Name | 1-(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)azocane;hydrochloride |
|---|---|
| PubChem CID | 154885101 |
| Molecular Formula | C17H29ClN4O2S |
| Molecular Weight | 388.97 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-(5-methylsulfonyl-4-piperidin-3-ylpyrimidin-2-yl)azocane;hydrochloride |
| SMILES | CS(=O)(=O)c1cnc(N2CCCCCCC2)nc1C1CCCNC1.Cl |
| InChI | InChI=1S/C17H28N4O2S.ClH/c1-24(22,23)15-13-19-17(21-10-5-3-2-4-6-11-21)20-16(15)14-8-7-9-18-12-14;/h13-14,18H,2-12H2,1H3;1H |
| InChIKey | RISHELGTHQEIAT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.97 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |