C19H28N4OS — CID 70717074
1-[(3aS,6aS)-5-(4-cyclopentylpyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-methylsulfanylpropan-1-one (PubChem CID 70717074) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is 1-[(3aS,6aS)-5-(4-cyclopentylpyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-methylsulfanylpropan-1-one.
| Compound Name | 1-[(3aS,6aS)-5-(4-cyclopentylpyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-methylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 70717074 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[(3aS,6aS)-5-(4-cyclopentylpyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-methylsulfanylpropan-1-one |
| SMILES | CSCCC(=O)N1CC[C@H]2CN(c3nccc(C4CCCC4)n3)C[C@H]21 |
| InChI | InChI=1S/C19H28N4OS/c1-25-11-8-18(24)23-10-7-15-12-22(13-17(15)23)19-20-9-6-16(21-19)14-4-2-3-5-14/h6,9,14-15,17H,2-5,7-8,10-13H2,1H3/t15-,17+/m0/s1 |
| InChIKey | AWORLXULZDEIFL-DOTOQJQBSA-N |
| XLogP | 2.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |