C16H16N4O4 — CID 70719104
7-[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]-2,7-diazaspiro[4.4]nonane-1,3-dione (PubChem CID 70719104) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 7-[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]-2,7-diazaspiro[4.4]nonane-1,3-dione.
| Compound Name | 7-[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]-2,7-diazaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 70719104 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 7-[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]-2,7-diazaspiro[4.4]nonane-1,3-dione |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCC4(CC(=O)NC4=O)C3)n[nH]2)o1 |
| InChI | InChI=1S/C16H16N4O4/c1-9-2-3-12(24-9)10-6-11(19-18-10)14(22)20-5-4-16(8-20)7-13(21)17-15(16)23/h2-3,6H,4-5,7-8H2,1H3,(H,18,19)(H,17,21,23) |
| InChIKey | DSUAZJSQAUTRDT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|