C20H18N4O3 — CID 7072115
(2S)-5-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(1H-benzimidazol-2-yl)-3-oxopentanenitrile (PubChem CID 7072115) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is (2S)-5-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(1H-benzimidazol-2-yl)-3-oxopentanenitrile.
| Compound Name | (2S)-5-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(1H-benzimidazol-2-yl)-3-oxopentanenitrile |
|---|---|
| PubChem CID | 7072115 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2S)-5-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-(1H-benzimidazol-2-yl)-3-oxopentanenitrile |
| SMILES | N#C[C@H](C(=O)CCN1C(=O)[C@@H]2CC=CC[C@H]2C1=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H18N4O3/c21-11-14(18-22-15-7-3-4-8-16(15)23-18)17(25)9-10-24-19(26)12-5-1-2-6-13(12)20(24)27/h1-4,7-8,12-14H,5-6,9-10H2,(H,22,23)/t12-,13-,14-/m1/s1 |
| InChIKey | JHWPSDWPELTFGM-MGPQQGTHSA-N |
| XLogP | 2.08 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|