C21H27N7O — CID 70725201
1,1-dimethyl-3-[[5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea (PubChem CID 70725201) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 1,1-dimethyl-3-[[5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea.
| Compound Name | 1,1-dimethyl-3-[[5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 70725201 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 1,1-dimethyl-3-[[5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]urea |
| SMILES | CN(C)C(=O)NCc1cc2n(n1)CCCN(Cc1cn[nH]c1-c1ccccc1)C2 |
| InChI | InChI=1S/C21H27N7O/c1-26(2)21(29)22-13-18-11-19-15-27(9-6-10-28(19)25-18)14-17-12-23-24-20(17)16-7-4-3-5-8-16/h3-5,7-8,11-12H,6,9-10,13-15H2,1-2H3,(H,22,29)(H,23,24) |
| InChIKey | DJWNVGAFPXQDAF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |