C19H29N7O — CID 70737930
3-[[5-[[6-(dimethylamino)-3-pyridinyl]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea (PubChem CID 70737930) has the molecular formula C19H29N7O and a molecular weight of 371.49 g/mol. Its IUPAC name is 3-[[5-[[6-(dimethylamino)-3-pyridinyl]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[5-[[6-(dimethylamino)-3-pyridinyl]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 70737930 |
| Molecular Formula | C19H29N7O |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 3-[[5-[[6-(dimethylamino)-3-pyridinyl]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCc1cc2n(n1)CCCN(Cc1ccc(N(C)C)nc1)C2 |
| InChI | InChI=1S/C19H29N7O/c1-23(2)18-7-6-15(11-20-18)13-25-8-5-9-26-17(14-25)10-16(22-26)12-21-19(27)24(3)4/h6-7,10-11H,5,8-9,12-14H2,1-4H3,(H,21,27) |
| InChIKey | GQGGQFLDUJWCAH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |