C19H18FN3O2S — CID 70726537
1-[4-[4-(6-fluoro-1H-benzimidazol-2-yl)piperidine-1-carbonyl]thiophen-2-yl]ethanone (PubChem CID 70726537) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[4-[4-(6-fluoro-1H-benzimidazol-2-yl)piperidine-1-carbonyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[4-[4-(6-fluoro-1H-benzimidazol-2-yl)piperidine-1-carbonyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 70726537 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-[4-[4-(6-fluoro-1H-benzimidazol-2-yl)piperidine-1-carbonyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc(C(=O)N2CCC(c3nc4ccc(F)cc4[nH]3)CC2)cs1 |
| InChI | InChI=1S/C19H18FN3O2S/c1-11(24)17-8-13(10-26-17)19(25)23-6-4-12(5-7-23)18-21-15-3-2-14(20)9-16(15)22-18/h2-3,8-10,12H,4-7H2,1H3,(H,21,22) |
| InChIKey | GEHCQHSDLGHVCA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |