C21H32N4O — CID 70728906
4-[4-[[4-(2-imidazol-1-ylethyl)piperazin-1-yl]methyl]phenyl]-2-methylbutan-2-ol (PubChem CID 70728906) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 4-[4-[[4-(2-imidazol-1-ylethyl)piperazin-1-yl]methyl]phenyl]-2-methylbutan-2-ol.
| Compound Name | 4-[4-[[4-(2-imidazol-1-ylethyl)piperazin-1-yl]methyl]phenyl]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 70728906 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 4-[4-[[4-(2-imidazol-1-ylethyl)piperazin-1-yl]methyl]phenyl]-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCc1ccc(CN2CCN(CCn3ccnc3)CC2)cc1 |
| InChI | InChI=1S/C21H32N4O/c1-21(2,26)8-7-19-3-5-20(6-4-19)17-24-14-11-23(12-15-24)13-16-25-10-9-22-18-25/h3-6,9-10,18,26H,7-8,11-17H2,1-2H3 |
| InChIKey | XWDHCBWXXVGUCQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |