C15H23FN4O — CID 70729342
[3-(cyclopropylmethyl)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]piperidin-3-yl]methanol (PubChem CID 70729342) has the molecular formula C15H23FN4O and a molecular weight of 294.37 g/mol. Its IUPAC name is [3-(cyclopropylmethyl)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]piperidin-3-yl]methanol.
| Compound Name | [3-(cyclopropylmethyl)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 70729342 |
| Molecular Formula | C15H23FN4O |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | [3-(cyclopropylmethyl)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]piperidin-3-yl]methanol |
| SMILES | CNc1nc(N2CCCC(CO)(CC3CC3)C2)ncc1F |
| InChI | InChI=1S/C15H23FN4O/c1-17-13-12(16)8-18-14(19-13)20-6-2-5-15(9-20,10-21)7-11-3-4-11/h8,11,21H,2-7,9-10H2,1H3,(H,17,18,19) |
| InChIKey | RECANPQMZKQTKO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |