C21H34N4O2 — CID 70729461
2-(3-methoxypropyl)-8-(6-methyl-2-propan-2-ylpyrimidin-4-yl)-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 70729461) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-8-(6-methyl-2-propan-2-ylpyrimidin-4-yl)-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-(3-methoxypropyl)-8-(6-methyl-2-propan-2-ylpyrimidin-4-yl)-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 70729461 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 2-(3-methoxypropyl)-8-(6-methyl-2-propan-2-ylpyrimidin-4-yl)-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | COCCCN1CC2(CCCN(c3cc(C)nc(C(C)C)n3)C2)CCC1=O |
| InChI | InChI=1S/C21H34N4O2/c1-16(2)20-22-17(3)13-18(23-20)24-10-5-8-21(14-24)9-7-19(26)25(15-21)11-6-12-27-4/h13,16H,5-12,14-15H2,1-4H3 |
| InChIKey | SGWFDFAPGINFMD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|