C19H32N4O2 — CID 95895959
(6R)-2-(3-methoxypropyl)-8-[2-(3-methylpyrazol-1-yl)ethyl]-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 95895959) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (6R)-2-(3-methoxypropyl)-8-[2-(3-methylpyrazol-1-yl)ethyl]-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | (6R)-2-(3-methoxypropyl)-8-[2-(3-methylpyrazol-1-yl)ethyl]-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 95895959 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (6R)-2-(3-methoxypropyl)-8-[2-(3-methylpyrazol-1-yl)ethyl]-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | COCCCN1C[C@]2(CCCN(CCn3ccc(C)n3)C2)CCC1=O |
| InChI | InChI=1S/C19H32N4O2/c1-17-6-11-23(20-17)13-12-21-9-3-7-19(15-21)8-5-18(24)22(16-19)10-4-14-25-2/h6,11H,3-5,7-10,12-16H2,1-2H3/t19-/m1/s1 |
| InChIKey | XNZAQNWHHGEBFO-LJQANCHMSA-N |
| XLogP | 1.93 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|