C18H30N4O3 — CID 95870181
(6S)-8-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-2-(3-methoxypropyl)-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 95870181) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is (6S)-8-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-2-(3-methoxypropyl)-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | (6S)-8-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-2-(3-methoxypropyl)-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 95870181 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (6S)-8-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-2-(3-methoxypropyl)-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | CCc1nc(CN2CCC[C@]3(CCC(=O)N(CCCOC)C3)C2)no1 |
| InChI | InChI=1S/C18H30N4O3/c1-3-16-19-15(20-25-16)12-21-9-4-7-18(13-21)8-6-17(23)22(14-18)10-5-11-24-2/h3-14H2,1-2H3/t18-/m0/s1 |
| InChIKey | ROOIUOKUSMWJPP-SFHVURJKSA-N |
| XLogP | 1.87 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|