C18H29N3O3 — CID 70749883
2-(3-methoxypropyl)-9-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 70749883) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-9-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-(3-methoxypropyl)-9-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 70749883 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 2-(3-methoxypropyl)-9-[(3-methyl-1,2-oxazol-5-yl)methyl]-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | COCCCN1CC2(CCC1=O)CCN(Cc1cc(C)no1)CC2 |
| InChI | InChI=1S/C18H29N3O3/c1-15-12-16(24-19-15)13-20-9-6-18(7-10-20)5-4-17(22)21(14-18)8-3-11-23-2/h12H,3-11,13-14H2,1-2H3 |
| InChIKey | URWWKLASNREJFE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|