C17H28N4O2S — CID 95862033
(6S)-2-(3-methoxypropyl)-8-[(4-methylthiadiazol-5-yl)methyl]-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 95862033) has the molecular formula C17H28N4O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is (6S)-2-(3-methoxypropyl)-8-[(4-methylthiadiazol-5-yl)methyl]-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | (6S)-2-(3-methoxypropyl)-8-[(4-methylthiadiazol-5-yl)methyl]-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 95862033 |
| Molecular Formula | C17H28N4O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (6S)-2-(3-methoxypropyl)-8-[(4-methylthiadiazol-5-yl)methyl]-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | COCCCN1C[C@@]2(CCCN(Cc3snnc3C)C2)CCC1=O |
| InChI | InChI=1S/C17H28N4O2S/c1-14-15(24-19-18-14)11-20-8-3-6-17(12-20)7-5-16(22)21(13-17)9-4-10-23-2/h3-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | NHBKZMXKTKOUQM-KRWDZBQOSA-N |
| XLogP | 2.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|