C19H26N2O4S — CID 70734533
5-[3-[2-(3-methoxypropyl)piperidin-1-yl]sulfonyl-4-methylphenyl]-1,2-oxazole (PubChem CID 70734533) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 5-[3-[2-(3-methoxypropyl)piperidin-1-yl]sulfonyl-4-methylphenyl]-1,2-oxazole.
| Compound Name | 5-[3-[2-(3-methoxypropyl)piperidin-1-yl]sulfonyl-4-methylphenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 70734533 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 5-[3-[2-(3-methoxypropyl)piperidin-1-yl]sulfonyl-4-methylphenyl]-1,2-oxazole |
| SMILES | COCCCC1CCCCN1S(=O)(=O)c1cc(-c2ccno2)ccc1C |
| InChI | InChI=1S/C19H26N2O4S/c1-15-8-9-16(18-10-11-20-25-18)14-19(15)26(22,23)21-12-4-3-6-17(21)7-5-13-24-2/h8-11,14,17H,3-7,12-13H2,1-2H3 |
| InChIKey | IKPUFKGFZHPFCV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|