C20H30N4O2 — CID 70735007
4-[(3-hexyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)methyl]-1-methylpyrrole-2-carbonitrile (PubChem CID 70735007) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-[(3-hexyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)methyl]-1-methylpyrrole-2-carbonitrile.
| Compound Name | 4-[(3-hexyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)methyl]-1-methylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 70735007 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 4-[(3-hexyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)methyl]-1-methylpyrrole-2-carbonitrile |
| SMILES | CCCCCCN1CC2(CCN(Cc3cc(C#N)n(C)c3)CC2)OC1=O |
| InChI | InChI=1S/C20H30N4O2/c1-3-4-5-6-9-24-16-20(26-19(24)25)7-10-23(11-8-20)15-17-12-18(13-21)22(2)14-17/h12,14H,3-11,15-16H2,1-2H3 |
| InChIKey | BRKUKQBTYGAMDA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|