C14H26N2O2 — CID 70740474
3-hexyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 70740474) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-hexyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 3-hexyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 70740474 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 3-hexyl-8-methyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | CCCCCCN1CC2(CCN(C)CC2)OC1=O |
| InChI | InChI=1S/C14H26N2O2/c1-3-4-5-6-9-16-12-14(18-13(16)17)7-10-15(2)11-8-14/h3-12H2,1-2H3 |
| InChIKey | PSJDJEJKTATZIF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|